cas: 53589-27-8 — see every product listed under this CAS number, including other names
5-Acetyl-2-Aminobenzoic Acid, 97%+,RG, 97%+,RG (CAS 53589-27-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DJLU-250mg |
| cas | 53589-27-8 |
| size | 250mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 266.00 Pln |
| purity | 97%+,RG |
|---|---|
| delivery time | 3 weeks |
5-acetyl-2-aminobenzoic acid (CAS 53589-27-8) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 5-acetyl-2-aminobenzoic acid. InChIKey: UHAJXWNQVHUJAH-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 5-acetyl-2-aminobenzoic acid |
| InChIKey | UHAJXWNQVHUJAH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)N)C(=O)O |
Computed by PubChem (NCBI)