cas: 132522-83-9 — see every product listed under this CAS number, including other names
5-Amino-4-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-one, 95+% (CAS 132522-83-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A550690-5g |
| cas | 132522-83-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15641.92 Pln | |
| AmBeed | 10g | 27574.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-amino-4-methyl-1,4-benzoxazin-3-one (CAS 132522-83-9) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 5-amino-4-methyl-1,4-benzoxazin-3-one. InChIKey: WFBXYEPLEPAVMO-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 5-amino-4-methyl-1,4-benzoxazin-3-one |
| InChIKey | WFBXYEPLEPAVMO-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=CC=CC(=C21)N |
Computed by PubChem (NCBI)