cas: 22094-61-7 — see every product listed under this CAS number, including other names
5-Aminobenzo(d)isothiazol-3(2H)-one 1,1-dioxide, 97% (CAS 22094-61-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A583731-250mg |
| cas | 22094-61-7 |
| size | 250mg |
| availability | USA Stock: 0.14g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 629.86 Pln | |
| AmBeed | 5g | 5336.59 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-amino-1,1-dioxo-1,2-benzothiazol-3-one (CAS 22094-61-7) is a chemical compound with the molecular formula C7H6N2O3S and a molecular weight of 198.20 g/mol. IUPAC name: 5-amino-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: XHLASMNHDRLNJQ-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 5-amino-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | XHLASMNHDRLNJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)NS2(=O)=O |
Computed by PubChem (NCBI)