CAS 933686-94-3 is the registry number for 2-(5-Oxo-5,6-dihydroimidazo[2,1-b]thiazol-3-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-oxo-6H-imidazo[2,1-b][1,3]thiazol-3-yl)acetic acid (CAS 933686-94-3) is a chemical compound with the molecular formula C7H6N2O3S and a molecular weight of 198.20 g/mol. IUPAC name: 2-(5-oxo-6H-imidazo[2,1-b][1,3]thiazol-3-yl)acetic acid. InChIKey: ISCWHGNLCXTVRG-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 2-(5-oxo-6H-imidazo[2,1-b][1,3]thiazol-3-yl)acetic acid |
| InChIKey | ISCWHGNLCXTVRG-UHFFFAOYSA-N |
| SMILES | C1C(=O)N2C(=CSC2=N1)CC(=O)O |
Computed by PubChem (NCBI)