CAS 13338-00-6 appears in our catalog under these names: 2H-1,2,4-Benzothiadiazin-3(4h)-one 1,1-dioxide, 95%, 2H-1,2,4-Benzothiadiazin-3(4H)-one 1,1-dioxide, 2H-Benzo[e][1,2,4]thiadiazin-3(4H)-one 1,1-dioxide, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 5g, 2,5g, 250mg.
1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-one (CAS 13338-00-6) is a chemical compound with the molecular formula C7H6N2O3S and a molecular weight of 198.20 g/mol. IUPAC name: 1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-one. InChIKey: QCHXXLQQTWUIRQ-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-one |
| InChIKey | QCHXXLQQTWUIRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)NS2(=O)=O |
Computed by PubChem (NCBI)