CAS 22094-61-7 appears in our catalog under these names: 5-Amino-1,2-benzisothiazol-3-(2H)-one 1,1-dioxide, 95%, 5-Aminobenzo(d)isothiazol-3(2H)-one 1,1-dioxide, 97%, 5-Amino-2,3-dihydro-1,2-benzothiazole-1,1,3-trione, 5-Aminobenzo[d]isothiazol-3(2H)-one 1,1-dioxide 97%. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
5-amino-1,1-dioxo-1,2-benzothiazol-3-one (CAS 22094-61-7) is a chemical compound with the molecular formula C7H6N2O3S and a molecular weight of 198.20 g/mol. IUPAC name: 5-amino-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: XHLASMNHDRLNJQ-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 5-amino-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | XHLASMNHDRLNJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)NS2(=O)=O |
Computed by PubChem (NCBI)