CAS 89975-86-0 is the registry number for 7-Aminobenzo(d)isothiazol-3(2H)-one 1,1-dioxide, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
7-amino-1,1-dioxo-1,2-benzothiazol-3-one (CAS 89975-86-0) is a chemical compound with the molecular formula C7H6N2O3S and a molecular weight of 198.20 g/mol. IUPAC name: 7-amino-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: TVTYWZAUGVDZKU-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 7-amino-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | TVTYWZAUGVDZKU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)