Products 19789-91-4
CAS 19789-91-4 is the registry number for (Z)-4-Oxo-4-(thiazol-2-ylamino)but-2-enoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(Z)-4-oxo-4-(1,3-thiazol-2-ylamino)but-2-enoic acid (CAS 19789-91-4) is a chemical compound with the molecular formula C7H6N2O3S and a molecular weight of 198.20 g/mol. IUPAC name: (Z)-4-oxo-4-(1,3-thiazol-2-ylamino)but-2-enoic acid. InChIKey: UUHHOCIQPDUBSP-UPHRSURJSA-N.
| Molecular formula | C7H6N2O3S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | (Z)-4-oxo-4-(1,3-thiazol-2-ylamino)but-2-enoic acid |
| InChIKey | UUHHOCIQPDUBSP-UPHRSURJSA-N |
| SMILES | C1=CSC(=N1)NC(=O)/C=C\C(=O)O |
Computed by PubChem (NCBI)