CAS 22094-62-8 appears in our catalog under these names: 6-Amino-1,1-dioxo-1,2-benzothiazol-3-one, 95%, 6–Aminosaccharin, 6-Amino-1,1-dioxo-1,2-benzothiazol-3-one, 6-Aminobenzo[d]isothiazol-3(2H)-one 1,1-dioxide 95%, 6-aminosaccharin, 98%+, 98%+. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 0,1g, 0,05g, 0,5g, 100mg, 5g.
6-amino-1,1-dioxo-1,2-benzothiazol-3-one (CAS 22094-62-8) is a chemical compound with the molecular formula C7H6N2O3S and a molecular weight of 198.20 g/mol. IUPAC name: 6-amino-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: SSRKZHLPNHLAKM-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 6-amino-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | SSRKZHLPNHLAKM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)