cas: 21302-43-2 — see every product listed under this CAS number, including other names
5-Aminoquinolin-8-ol dihydrochloride (CAS 21302-43-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242702-1G |
| cas | 21302-43-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 1034.03 Pln | |
| Fluorochem | 25g | 3777.85 Pln | |
| Fluorochem | 100g | 14154.41 Pln |
| delivery time | 2-3 weeks |
|---|
5-aminoquinolin-8-ol;dihydrochloride (CAS 21302-43-2) is a chemical compound with the molecular formula C9H10Cl2N2O and a molecular weight of 233.09 g/mol. IUPAC name: 5-aminoquinolin-8-ol;dihydrochloride. InChIKey: VTQDJAUGGZFPOI-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2O |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 5-aminoquinolin-8-ol;dihydrochloride |
| InChIKey | VTQDJAUGGZFPOI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)O)N.Cl.Cl |
Computed by PubChem (NCBI)