CAS 21302-43-2 appears in our catalog under these names: 5-Amino-8-hydroxyquinoline dihydrochloride, 96%, 5–Amino–8–hydroxyquinoline Dihydrochloride, 5-Amino-8-hydroxyquinoline dihydrochloride, 5-Amino-8-hydroxyquinoline Dihydrochloride, >98.0%(HPLC)(T), 5-AMINO-8-HYDROXYQUINOLINE DIHYDRO-CHLOR. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 10g, 100g, 5g, 1g, 25g, 50g, 100mg, 250mg.
5-aminoquinolin-8-ol;dihydrochloride (CAS 21302-43-2) is a chemical compound with the molecular formula C9H10Cl2N2O and a molecular weight of 233.09 g/mol. IUPAC name: 5-aminoquinolin-8-ol;dihydrochloride. InChIKey: VTQDJAUGGZFPOI-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2O |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 5-aminoquinolin-8-ol;dihydrochloride |
| InChIKey | VTQDJAUGGZFPOI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)O)N.Cl.Cl |
Computed by PubChem (NCBI)