CAS 2080361-18-6 is the registry number for 4,6-Dichloro-2-(tetrahydro-2H-pyran-2-yl)pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-2-(oxan-2-yl)pyrimidine (CAS 2080361-18-6) is a chemical compound with the molecular formula C9H10Cl2N2O and a molecular weight of 233.09 g/mol. IUPAC name: 4,6-dichloro-2-(oxan-2-yl)pyrimidine. InChIKey: JDKWTOASCFJPCP-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2O |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 4,6-dichloro-2-(oxan-2-yl)pyrimidine |
| InChIKey | JDKWTOASCFJPCP-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)C2=NC(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)