cas: 21302-43-2 — see every product listed under this CAS number, including other names
5-Aminoquinolin-8-ol dihydrochloride , ≥98%, ≥98% (CAS 21302-43-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MEN-100mg |
| cas | 21302-43-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 467.60 Pln | |
| Chemat | 25g | 1638.80 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
5-aminoquinolin-8-ol;dihydrochloride (CAS 21302-43-2) is a chemical compound with the molecular formula C9H10Cl2N2O and a molecular weight of 233.09 g/mol. IUPAC name: 5-aminoquinolin-8-ol;dihydrochloride. InChIKey: VTQDJAUGGZFPOI-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2O |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 5-aminoquinolin-8-ol;dihydrochloride |
| InChIKey | VTQDJAUGGZFPOI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)O)N.Cl.Cl |
Computed by PubChem (NCBI)