cas: 21302-43-2 — see every product listed under this CAS number, including other names
5-Amino-8-hydroxyquinoline Dihydrochloride, >98.0%(HPLC)(T) (CAS 21302-43-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A1005-5G |
| cas | 21302-43-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 536.31 Pln | |
| TCI | 25g | 1755.79 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
5-aminoquinolin-8-ol;dihydrochloride (CAS 21302-43-2) is a chemical compound with the molecular formula C9H10Cl2N2O and a molecular weight of 233.09 g/mol. IUPAC name: 5-aminoquinolin-8-ol;dihydrochloride. InChIKey: VTQDJAUGGZFPOI-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2O |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 5-aminoquinolin-8-ol;dihydrochloride |
| InChIKey | VTQDJAUGGZFPOI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)O)N.Cl.Cl |
Computed by PubChem (NCBI)