CAS 2270912-54-2 appears in our catalog under these names: 8-Amino-6-chloro-3,4-dihydroquinolin-2(1h)-one hydrochloride, 95%, 8-Amino-6-chloro-3,4-dihydroquinolin-2(1H)-one hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
8-amino-6-chloro-3,4-dihydro-1H-quinolin-2-one;hydrochloride (CAS 2270912-54-2) is a chemical compound with the molecular formula C9H10Cl2N2O and a molecular weight of 233.09 g/mol. IUPAC name: 8-amino-6-chloro-3,4-dihydro-1H-quinolin-2-one;hydrochloride. InChIKey: ZDSFKOGLJHDOBR-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2O |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 8-amino-6-chloro-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
| InChIKey | ZDSFKOGLJHDOBR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC2=C1C=C(C=C2N)Cl.Cl |
Computed by PubChem (NCBI)