CAS 1158341-14-0 appears in our catalog under these names: 2-(5-Chloro-1,3-benzoxazol-2-yl)ethanamine hydrochloride, 95%, 2-(5-Chlorobenzo(d)oxazol-2-yl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-(5-chloro-1,3-benzoxazol-2-yl)ethanamine;hydrochloride (CAS 1158341-14-0) is a chemical compound with the molecular formula C9H10Cl2N2O and a molecular weight of 233.09 g/mol. IUPAC name: 2-(5-chloro-1,3-benzoxazol-2-yl)ethanamine;hydrochloride. InChIKey: SOXUVEQJYSXLDZ-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2O |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 2-(5-chloro-1,3-benzoxazol-2-yl)ethanamine;hydrochloride |
| InChIKey | SOXUVEQJYSXLDZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(O2)CCN.Cl |
Computed by PubChem (NCBI)