cas: 1379779-22-2 — see every product listed under this CAS number, including other names
5-BROMO-2-HYDROXY-4-METHOXYBENZONITRILE, 95%, 95% (CAS 1379779-22-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1128RL-100mg |
| cas | 1379779-22-2 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 760.40 Pln | |
| Chemat | 250mg | 1346.00 Pln | |
| Chemat | 500mg | 2114.00 Pln | |
| Chemat | 1g | 3621.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-hydroxy-4-methoxybenzonitrile (CAS 1379779-22-2) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 5-bromo-2-hydroxy-4-methoxybenzonitrile. InChIKey: UCBVLFPUDKPKAC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 5-bromo-2-hydroxy-4-methoxybenzonitrile |
| InChIKey | UCBVLFPUDKPKAC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)O)C#N)Br |
Computed by PubChem (NCBI)