cas: 913836-03-0 — see every product listed under this CAS number, including other names
5-Borononicotinic Acid, 98%, 98% (CAS 913836-03-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MLH-100mg |
| cas | 913836-03-0 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 506.00 Pln | |
| Chemat | 5g | 2138.00 Pln | |
| Chemat | 10g | 3386.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-boronopyridine-3-carboxylic acid (CAS 913836-03-0) is a chemical compound with the molecular formula C6H6BNO4 and a molecular weight of 166.93 g/mol. IUPAC name: 5-boronopyridine-3-carboxylic acid. InChIKey: XKDATYTUCBKUQZ-UHFFFAOYSA-N.
| Molecular formula | C6H6BNO4 |
|---|---|
| Molecular weight | 166.93 g/mol |
| IUPAC name | 5-boronopyridine-3-carboxylic acid |
| InChIKey | XKDATYTUCBKUQZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)C(=O)O)(O)O |
Computed by PubChem (NCBI)