cas: 913836-11-0 — see every product listed under this CAS number, including other names
5-Boronopicolinic acid, 95% (CAS 913836-11-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F231168-100MG |
| cas | 913836-11-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 500mg | 581.06 Pln | |
| Fluorochem | 1g | 862.21 Pln | |
| Fluorochem | 5g | 2481.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-boronopyridine-2-carboxylic acid (CAS 913836-11-0) is a chemical compound with the molecular formula C6H6BNO4 and a molecular weight of 166.93 g/mol. IUPAC name: 5-boronopyridine-2-carboxylic acid. InChIKey: UEKWXZLQKGKCEQ-UHFFFAOYSA-N.
| Molecular formula | C6H6BNO4 |
|---|---|
| Molecular weight | 166.93 g/mol |
| IUPAC name | 5-boronopyridine-2-carboxylic acid |
| InChIKey | UEKWXZLQKGKCEQ-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)C(=O)O)(O)O |
Computed by PubChem (NCBI)