cas: 885069-03-4 — see every product listed under this CAS number, including other names
5-Bromo-2,3-dihydrobenzofuran-2-carboxylic acid 98% (CAS 885069-03-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A951352-100mg |
| cas | 885069-03-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 392.62 Pln | |
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 1594.12 Pln | |
| Ambeed | 5g | 4675.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A951352 |
5-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid (CAS 885069-03-4) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid. InChIKey: MWNCCBAITNRTSN-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1-benzofuran-2-carboxylic acid |
| InChIKey | MWNCCBAITNRTSN-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C1C=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)