CAS 287172-61-6 is the registry number for 5-Bromo-2,4-difluorobenzenesulfonyl chloride, 97%. Offered by: Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 500g.
5-bromo-2,4-difluorobenzenesulfonyl chloride (CAS 287172-61-6) is a chemical compound with the molecular formula C6H2BrClF2O2S and a molecular weight of 291.50 g/mol. IUPAC name: 5-bromo-2,4-difluorobenzenesulfonyl chloride. InChIKey: GSNAPAYUOACKRN-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF2O2S |
|---|---|
| Molecular weight | 291.50 g/mol |
| IUPAC name | 5-bromo-2,4-difluorobenzenesulfonyl chloride |
| InChIKey | GSNAPAYUOACKRN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)