cas: 110704-48-8 — see every product listed under this CAS number, including other names
5-Bromo-2-(chloromethyl)-1,3-benzoxazole, 95%, 95% (CAS 110704-48-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1101Z2-1g |
| cas | 110704-48-8 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1653.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-(chloromethyl)-1,3-benzoxazole (CAS 110704-48-8) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 5-bromo-2-(chloromethyl)-1,3-benzoxazole. InChIKey: CWONURXPYBVLGQ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 5-bromo-2-(chloromethyl)-1,3-benzoxazole |
| InChIKey | CWONURXPYBVLGQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=C(O2)CCl |
Computed by PubChem (NCBI)