cas: 923281-52-1 — see every product listed under this CAS number, including other names
5-Bromo-2-(trifluoromethoxy)benzaldehyde 98% (CAS 923281-52-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A916819-1g |
| cas | 923281-52-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 270.25 Pln | |
| Ambeed | 10g | 442.69 Pln | |
| Ambeed | 25g | 971.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A916819 |
5-bromo-2-(trifluoromethoxy)benzaldehyde (CAS 923281-52-1) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 5-bromo-2-(trifluoromethoxy)benzaldehyde. InChIKey: IBEWLWBZTHFCPI-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 5-bromo-2-(trifluoromethoxy)benzaldehyde |
| InChIKey | IBEWLWBZTHFCPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C=O)OC(F)(F)F |
Computed by PubChem (NCBI)