cas: 773140-42-4 — see every product listed under this CAS number, including other names
5-Bromo-2-fluorobenzoyl chloride 95+% (CAS 773140-42-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A516281-100g |
| cas | 773140-42-4 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 16796.44 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1560.75 Pln | |
| Ambeed | 10g | 2684.38 Pln | |
| Ambeed | 25g | 5298.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A516281 |
5-bromo-2-fluorobenzoyl chloride (CAS 773140-42-4) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 5-bromo-2-fluorobenzoyl chloride. InChIKey: LEGBISULKASFCD-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 5-bromo-2-fluorobenzoyl chloride |
| InChIKey | LEGBISULKASFCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)Cl)F |
Computed by PubChem (NCBI)