cas: 773140-42-4 — see every product listed under this CAS number, including other names
5-Bromo-2-fluorobenzoyl chloride (CAS 773140-42-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038143-5G |
| cas | 773140-42-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1122.54 Pln | |
| Fluorochem | 10g | 1851.45 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-2-fluorobenzoyl chloride (CAS 773140-42-4) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 5-bromo-2-fluorobenzoyl chloride. InChIKey: LEGBISULKASFCD-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 5-bromo-2-fluorobenzoyl chloride |
| InChIKey | LEGBISULKASFCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)Cl)F |
Computed by PubChem (NCBI)