5-Bromo-2-fluorophenylacetic Acid, 98%, 98%
cas: 883514-21-4 — see every product listed under this CAS number, including other names
5-Bromo-2-fluorophenylacetic Acid, 98%, 98% (CAS 883514-21-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MH4-1g |
| cas | 883514-21-4 |
| size | 1g |
| availability | 300g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 203.60 Pln | |
| Chemat | 100g | 616.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(5-bromo-2-fluorophenyl)acetic acid (CAS 883514-21-4) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-(5-bromo-2-fluorophenyl)acetic acid. InChIKey: WSWMCZBGQYAYIS-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-(5-bromo-2-fluorophenyl)acetic acid |
| InChIKey | WSWMCZBGQYAYIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CC(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
2-(5-bromo-2-fluorophenyl)acetic acid, 5-Bromo-2-fluorophenylacetic acid, (5-bromo-2-fluorophenyl)acetic acid, (5-Bromo-2-fluoro-phenyl)-acetic acid, 5-Bromo-2-fluorophenylaceticacid, Benzeneacetic acid, 5-bromo-2-fluoro-, 2-(5-bromo-2-fluoro-phenyl)acetic Acid, WSWMCZBGQYAYIS-UHFFFAOYSA-N, 5-Bromo-2-fluorobenzeneacetic acid, 2,3-dihydro-1-(methylsulfonyl)-(1h)-indole-5-amine