CAS 4785-52-8 appears in our catalog under these names: 5–Bromo–2–formylbenzoic acid, 5-Bromo-2-formylbenzoic acid, 98%, 98%, 5-Bromo-2-formyl-benzoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 2.5g, 10g.
5-bromo-2-formylbenzoic acid (CAS 4785-52-8) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 5-bromo-2-formylbenzoic acid. InChIKey: WAMUJTFUQTUCJQ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 5-bromo-2-formylbenzoic acid |
| InChIKey | WAMUJTFUQTUCJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)O)C=O |
Computed by PubChem (NCBI)