5-Bromo-2-nitrophenol, 98%, 98%
cas: 27684-84-0 — see every product listed under this CAS number, including other names
5-Bromo-2-nitrophenol, 98%, 98% (CAS 27684-84-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113UFZ-1g |
| cas | 27684-84-0 |
| size | 1g |
| availability | 10000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 213.20 Pln | |
| Chemat | 50g | 366.80 Pln | |
| Chemat | 100g | 669.20 Pln | |
| Chemat | 250g | 1442.00 Pln | |
| Chemat | 1kg | 3717.20 Pln | |
| Chemat | 5kg | 17817.60 Pln | |
| Chemat | 10kg | price on request |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-nitrophenol (CAS 27684-84-0) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 5-bromo-2-nitrophenol. InChIKey: DTWHNSNSUBKGTC-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 5-bromo-2-nitrophenol |
| InChIKey | DTWHNSNSUBKGTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)