CAS 27684-84-0 appears in our catalog under these names: 5-Bromo-2-nitrophenol, 5–Bromo–2–nitrophenol, 5-Bromo-2-nitrophenol, 96% , 5-Bromo-2-nitrophenol, >98.0%(GC)(T), 5-Bromo-2-nitrophenol 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 10g, 5g, 25g, 50g, 100g, 250g, 1000g, 1g.
5-bromo-2-nitrophenol (CAS 27684-84-0) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 5-bromo-2-nitrophenol. InChIKey: DTWHNSNSUBKGTC-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 5-bromo-2-nitrophenol |
| InChIKey | DTWHNSNSUBKGTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)