cas: 1781052-25-2 — see every product listed under this CAS number, including other names
5-Bromo-4-chloro-2-fluorobenzaldehyde 97% (CAS 1781052-25-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A645548-250mg |
| cas | 1781052-25-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 2189.31 Pln | |
| Ambeed | 10g | 3607.75 Pln | |
| Ambeed | 25g | 6433.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A645548 |
5-bromo-4-chloro-2-fluorobenzaldehyde (CAS 1781052-25-2) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 5-bromo-4-chloro-2-fluorobenzaldehyde. InChIKey: XXIYYWQCGYDEFE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 5-bromo-4-chloro-2-fluorobenzaldehyde |
| InChIKey | XXIYYWQCGYDEFE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Cl)F)C=O |
Computed by PubChem (NCBI)