cas: 1781052-25-2 — see every product listed under this CAS number, including other names
5-Bromo-4-chloro-2-fluorobenzaldehyde (CAS 1781052-25-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F622605-1G |
| cas | 1781052-25-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1986.82 Pln | |
| Fluorochem | 5g | 5824.01 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-4-chloro-2-fluorobenzaldehyde (CAS 1781052-25-2) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 5-bromo-4-chloro-2-fluorobenzaldehyde. InChIKey: XXIYYWQCGYDEFE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 5-bromo-4-chloro-2-fluorobenzaldehyde |
| InChIKey | XXIYYWQCGYDEFE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Cl)F)C=O |
Computed by PubChem (NCBI)