cas: 31686-64-3 — see every product listed under this CAS number, including other names
5-Bromo-4-methyl-2-phenylpyridine, ≥97%, ≥97% (CAS 31686-64-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BZEO-100mg |
| cas | 31686-64-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 813.20 Pln | |
| Chemat | 250mg | 1192.40 Pln | |
| Chemat | 1g | 2886.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-4-methyl-2-phenylpyridine (CAS 31686-64-3) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 5-bromo-4-methyl-2-phenylpyridine. InChIKey: NUXIJRHGJXCNDZ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 5-bromo-4-methyl-2-phenylpyridine |
| InChIKey | NUXIJRHGJXCNDZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1Br)C2=CC=CC=C2 |
Computed by PubChem (NCBI)