cas: 723760-74-5 — see every product listed under this CAS number, including other names
5-Bromo-6-nitro-2,3-dihydro-1H-inden-1-one, 98% (CAS 723760-74-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212159-100MG |
| cas | 723760-74-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 284.29 Pln | |
| Fluorochem | 250mg | 539.41 Pln | |
| Fluorochem | 1g | 1289.15 Pln | |
| Fluorochem | 5g | 3975.70 Pln | |
| Fluorochem | 10g | 6500.85 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-6-nitro-2,3-dihydroinden-1-one (CAS 723760-74-5) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: 5-bromo-6-nitro-2,3-dihydroinden-1-one. InChIKey: MUTOBVAOAKQKMD-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | 5-bromo-6-nitro-2,3-dihydroinden-1-one |
| InChIKey | MUTOBVAOAKQKMD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)