CAS 37924-67-7 appears in our catalog under these names: Alpha-bromo-1,2-benzisoxazole-3-acetic acid, 95%, alpha-Bromo-1,2-benzisoxazole-3-acetic Acid, 2-(Benzo(d)isoxazol-3-yl)-2-bromoacetic acid, 97%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-(1,2-benzoxazol-3-yl)-2-bromoacetic acid (CAS 37924-67-7) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: 2-(1,2-benzoxazol-3-yl)-2-bromoacetic acid. InChIKey: GOEZDVVTYIWCAJ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | 2-(1,2-benzoxazol-3-yl)-2-bromoacetic acid |
| InChIKey | GOEZDVVTYIWCAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NO2)C(C(=O)O)Br |
Computed by PubChem (NCBI)