CAS 557093-36-4 is the registry number for 6-Bromo-2-oxo-2,3-dihydro-1h-indole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-2-oxo-1,3-dihydroindole-5-carboxylic acid (CAS 557093-36-4) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: 6-bromo-2-oxo-1,3-dihydroindole-5-carboxylic acid. InChIKey: YSDAAIVIVNBPEU-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | 6-bromo-2-oxo-1,3-dihydroindole-5-carboxylic acid |
| InChIKey | YSDAAIVIVNBPEU-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2NC1=O)Br)C(=O)O |
Computed by PubChem (NCBI)