cas: 10406-06-1 — see every product listed under this CAS number, including other names
5-Bromo-indole-3-carboxylic acid, 98% (CAS 10406-06-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037073-5G |
| cas | 10406-06-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 237.43 Pln | |
| Fluorochem | 25g | 471.73 Pln | |
| Fluorochem | 100g | 1325.59 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-bromo-1H-indole-3-carboxylic acid (CAS 10406-06-1) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 5-bromo-1H-indole-3-carboxylic acid. InChIKey: JVZMBSGNSAHFCY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 5-bromo-1H-indole-3-carboxylic acid |
| InChIKey | JVZMBSGNSAHFCY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)