CAS 98592-04-2 appears in our catalog under these names: Methyl 2–bromo–4–cyanobenzoate, Methyl 2-bromo-4-cyanobenzoate, 95%, Benzoic acid, 2-bromo-4-cyano-, methyl ester, 97%, 97%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg, 25g.
Methyl 2-bromo-4-cyanobenzoate (CAS 98592-04-2) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: methyl 2-bromo-4-cyanobenzoate. InChIKey: JSIGBTNTMZSLMO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | methyl 2-bromo-4-cyanobenzoate |
| InChIKey | JSIGBTNTMZSLMO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C#N)Br |
Computed by PubChem (NCBI)