5-Chloro-2,3-dimethoxybenzoic acid, 98%
cas: 72517-22-7 — see every product listed under this CAS number, including other names
5-Chloro-2,3-dimethoxybenzoic acid, 98% (CAS 72517-22-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1464524-5g |
| cas | 72517-22-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 16572.85 Pln | |
| Fluorochem | 50mg | 726.85 Pln | |
| Fluorochem | 100mg | 1164.19 Pln | |
| Fluorochem | 250mg | 1809.80 Pln | |
| Fluorochem | 500mg | 2913.58 Pln | |
| Fluorochem | 1g | 3527.94 Pln | |
| Fluorochem | 2.5g | 7078.78 Pln | |
| Fluorochem | 5g | 10431.76 Pln | |
| Fluorochem | 10g | 17700.04 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-chloro-2,3-dimethoxybenzoic acid (CAS 72517-22-7) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 5-chloro-2,3-dimethoxybenzoic acid. InChIKey: LRURKYFKJPEOMX-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 5-chloro-2,3-dimethoxybenzoic acid |
| InChIKey | LRURKYFKJPEOMX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)C(=O)O)Cl |
Computed by PubChem (NCBI)