CAS 6386-63-6 appears in our catalog under these names: 2-(4-Chloro-2-(hydroxymethyl)phenoxy)acetic acid, 95%, Cloxyfonac, Cloxyfonac, 95.09%, Cloxyfonac (Standard). Offered by: Combi-blocks, Dr. Ehrenstorfer, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 250mg, 1g, 5g, 25mg, 2mg, 0,25g, 100 mg, 10mM/1mL.
2-[4-chloro-2-(hydroxymethyl)phenoxy]acetic acid (CAS 6386-63-6) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 2-[4-chloro-2-(hydroxymethyl)phenoxy]acetic acid. InChIKey: ZJRUTGDCLVIVRD-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 2-[4-chloro-2-(hydroxymethyl)phenoxy]acetic acid |
| InChIKey | ZJRUTGDCLVIVRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CO)OCC(=O)O |
Computed by PubChem (NCBI)