Products 50597-60-9

CAS 50597-60-9 is the registry number for 4-Hydroxy-3,5-dimethoxybenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

4-hydroxy-3,5-dimethoxybenzoyl chloride (CAS 50597-60-9) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 4-hydroxy-3,5-dimethoxybenzoyl chloride. InChIKey: KQMFVBABPYFGIG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO4
Molecular weight216.62 g/mol
IUPAC name4-hydroxy-3,5-dimethoxybenzoyl chloride
InChIKeyKQMFVBABPYFGIG-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1O)OC)C(=O)Cl

Computed by PubChem (NCBI)