CAS 50597-60-9 is the registry number for 4-Hydroxy-3,5-dimethoxybenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
4-hydroxy-3,5-dimethoxybenzoyl chloride (CAS 50597-60-9) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 4-hydroxy-3,5-dimethoxybenzoyl chloride. InChIKey: KQMFVBABPYFGIG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 4-hydroxy-3,5-dimethoxybenzoyl chloride |
| InChIKey | KQMFVBABPYFGIG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)OC)C(=O)Cl |
Computed by PubChem (NCBI)