Products 23053-81-8
CAS 23053-81-8 appears in our catalog under these names: 5-Chloro-2,4-dimethoxybenzoic acid, 95%, 5-Chloro-2,4-dimethoxybenzoic acid, 97%, 5-Chloro-2,4-dimethoxybenzoic acid, 5-Chloro-2,4-dimethoxybenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.
5-chloro-2,4-dimethoxybenzoic acid (CAS 23053-81-8) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 5-chloro-2,4-dimethoxybenzoic acid. InChIKey: YVMAOAQQUJFELI-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 5-chloro-2,4-dimethoxybenzoic acid |
| InChIKey | YVMAOAQQUJFELI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)Cl)OC |
Computed by PubChem (NCBI)