CAS 23982-26-5 is the registry number for 2-(3-Chloro-4-methoxyphenyl)-2-hydroxyacetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chloro-4-methoxyphenyl)-2-hydroxyacetic acid (CAS 23982-26-5) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 2-(3-chloro-4-methoxyphenyl)-2-hydroxyacetic acid. InChIKey: CRCOCWUKCBKJJH-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 2-(3-chloro-4-methoxyphenyl)-2-hydroxyacetic acid |
| InChIKey | CRCOCWUKCBKJJH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C(=O)O)O)Cl |
Computed by PubChem (NCBI)