Products 23982-26-5

CAS 23982-26-5 is the registry number for 2-(3-Chloro-4-methoxyphenyl)-2-hydroxyacetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(3-chloro-4-methoxyphenyl)-2-hydroxyacetic acid (CAS 23982-26-5) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 2-(3-chloro-4-methoxyphenyl)-2-hydroxyacetic acid. InChIKey: CRCOCWUKCBKJJH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO4
Molecular weight216.62 g/mol
IUPAC name2-(3-chloro-4-methoxyphenyl)-2-hydroxyacetic acid
InChIKeyCRCOCWUKCBKJJH-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(C(=O)O)O)Cl

Computed by PubChem (NCBI)