CAS 42020-23-5 appears in our catalog under these names: 4-Chloro-2,5-dimethoxybenzoic acid, 95%, 4-Chloro-2,5-dimethoxybenzoic acid, 95+%, 4-Chloro-2,5-dimethoxy-benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg.
4-chloro-2,5-dimethoxybenzoic acid (CAS 42020-23-5) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 4-chloro-2,5-dimethoxybenzoic acid. InChIKey: OKZBREHFLFCMIC-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 4-chloro-2,5-dimethoxybenzoic acid |
| InChIKey | OKZBREHFLFCMIC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)OC)Cl |
Computed by PubChem (NCBI)