CAS 1700623-85-3 appears in our catalog under these names: 2-Chloro-4-(methoxymethoxy)-benzoic acid, 95%, 2-Chloro-4-(methoxymethoxy)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
2-chloro-4-(methoxymethoxy)benzoic acid (CAS 1700623-85-3) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 2-chloro-4-(methoxymethoxy)benzoic acid. InChIKey: NZROQFOVFDEYBH-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 2-chloro-4-(methoxymethoxy)benzoic acid |
| InChIKey | NZROQFOVFDEYBH-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)