cas: 1393536-52-1 — see every product listed under this CAS number, including other names
5-Chloro-2,4-dimethoxyphenylboronic acid (CAS 1393536-52-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627474-1G |
| cas | 1393536-52-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2189.87 Pln |
| delivery time | 3-4 weeks |
|---|
(5-chloro-2,4-dimethoxyphenyl)boronic acid (CAS 1393536-52-1) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: (5-chloro-2,4-dimethoxyphenyl)boronic acid. InChIKey: UIOZPTLAHPXVSO-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | (5-chloro-2,4-dimethoxyphenyl)boronic acid |
| InChIKey | UIOZPTLAHPXVSO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)OC)Cl)(O)O |
Computed by PubChem (NCBI)