CAS 1701449-18-4 is the registry number for 3-Chloro-4,5-dimethoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(3-chloro-4,5-dimethoxyphenyl)boronic acid (CAS 1701449-18-4) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: (3-chloro-4,5-dimethoxyphenyl)boronic acid. InChIKey: FMEZHQZTXJATTF-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | (3-chloro-4,5-dimethoxyphenyl)boronic acid |
| InChIKey | FMEZHQZTXJATTF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OC)OC)(O)O |
Computed by PubChem (NCBI)