CAS 1393536-52-1 appears in our catalog under these names: 5-Chloro-2,4-dimethoxyphenylboronic acid, 95%, 5-Chloro-2,4-dimethoxyphenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
(5-chloro-2,4-dimethoxyphenyl)boronic acid (CAS 1393536-52-1) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: (5-chloro-2,4-dimethoxyphenyl)boronic acid. InChIKey: UIOZPTLAHPXVSO-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | (5-chloro-2,4-dimethoxyphenyl)boronic acid |
| InChIKey | UIOZPTLAHPXVSO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)OC)Cl)(O)O |
Computed by PubChem (NCBI)