Products 1451392-27-0

CAS 1451392-27-0 appears in our catalog under these names: 3-Chloro-4-(methoxymethoxy)phenylboronic acid, 95%, (3-Chloro-4-(methoxymethoxy)phenyl)boronic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 2,5g.

Structural formula: {0} (CAS {1})

[3-chloro-4-(methoxymethoxy)phenyl]boronic acid (CAS 1451392-27-0) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: [3-chloro-4-(methoxymethoxy)phenyl]boronic acid. InChIKey: ISTZDEQGOZACDO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10BClO4
Molecular weight216.43 g/mol
IUPAC name[3-chloro-4-(methoxymethoxy)phenyl]boronic acid
InChIKeyISTZDEQGOZACDO-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)OCOC)Cl)(O)O

Computed by PubChem (NCBI)