Products 1451392-27-0
CAS 1451392-27-0 appears in our catalog under these names: 3-Chloro-4-(methoxymethoxy)phenylboronic acid, 95%, (3-Chloro-4-(methoxymethoxy)phenyl)boronic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 2,5g.
[3-chloro-4-(methoxymethoxy)phenyl]boronic acid (CAS 1451392-27-0) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: [3-chloro-4-(methoxymethoxy)phenyl]boronic acid. InChIKey: ISTZDEQGOZACDO-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | [3-chloro-4-(methoxymethoxy)phenyl]boronic acid |
| InChIKey | ISTZDEQGOZACDO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCOC)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
[3-chloro-4-(methoxymethoxy)phenyl]boronic acid, (3-Chloro-4-(methoxymethoxy)phenyl)boronic acid, 3-Chloro-4-(methoxymethoxy)phenylboronic acid, (3-Chloro-4-(methoxymethoxy)phenyl)boronicacid, B-[3-chloro-4-(methoxymethoxy)phenyl]boronic acid, Boronic acid, B-[3-chloro-4-(methoxymethoxy)phenyl]-