Products 1256355-47-1
CAS 1256355-47-1 appears in our catalog under these names: 3-Chloro-2-(methoxymethoxy)phenylboronic acid, 98%, (3-Chloro-2-(methoxymethoxy)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
[3-chloro-2-(methoxymethoxy)phenyl]boronic acid (CAS 1256355-47-1) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: [3-chloro-2-(methoxymethoxy)phenyl]boronic acid. InChIKey: OPGUYLBIFIOJNR-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | [3-chloro-2-(methoxymethoxy)phenyl]boronic acid |
| InChIKey | OPGUYLBIFIOJNR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Cl)OCOC)(O)O |
Computed by PubChem (NCBI)