Products 609352-56-9

CAS 609352-56-9 appears in our catalog under these names: 5-Chloro-2-(methoxymethoxy)phenylboronic acid, 97%, (5-Chloro-2-(methoxymethoxy)phenyl)boronic acid, 97%, (5-Chloro-2-(methoxymethoxy)phenyl)boronic acid, ≥95%, ≥95%, (5-Chloro-2-(methoxymethoxy)phenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

[5-chloro-2-(methoxymethoxy)phenyl]boronic acid (CAS 609352-56-9) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: [5-chloro-2-(methoxymethoxy)phenyl]boronic acid. InChIKey: QTWCKSWCYVBQTN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10BClO4
Molecular weight216.43 g/mol
IUPAC name[5-chloro-2-(methoxymethoxy)phenyl]boronic acid
InChIKeyQTWCKSWCYVBQTN-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)Cl)OCOC)(O)O

Computed by PubChem (NCBI)